About carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine
carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine (PubChem CID 160540903) has the molecular formula C19H22NOS2+
and a molecular weight of 344.53 g/mol. Its IUPAC name is carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine.
Molecular Properties
| Compound Name | carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine |
| PubChem CID | 160540903 |
| Molecular Formula | C19H22NOS2+ |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine |
| SMILES | Cc1cc2ccc(OCCCCSc3ccncc3)cc2s1.[CH3+] |
| InChI | InChI=1S/C18H19NOS2.CH3/c1-14-12-15-4-5-16(13-18(15)22-14)20-10-2-3-11-21-17-6-8-19-9-7-17;/h4-9,12-13H,2-3,10-11H2,1H3;1H3/q;+1 |
| InChIKey | QWTPKQADFCQSKG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine?
The IUPAC name of carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine (CID 160540903) is carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine.
What is the SMILES notation for carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine?
The canonical SMILES for carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine is Cc1cc2ccc(OCCCCSc3ccncc3)cc2s1.[CH3+].
What is the InChIKey of carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine?
The InChIKey is QWTPKQADFCQSKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NOS2.CH3/c1-14-12-15-4-5-16(13-18(15)22-14)20-10-2-3-11-21-17-6-8-19-9-7-17;/h4-9,12-13H,2-3,10-11H2,1H3;1H3/q;+1.
What are the key properties of carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine?
carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine has a molecular weight of 344.53 g/mol, XLogP of 6.01, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbanylium;4-[4-[(2-methyl-1-benzothiophen-6-yl)oxy]butylsulfanyl]pyridine is sourced from PubChem (CID 160540903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).