About tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole
tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 160541989) has the molecular formula C21H27N5O4S
and a molecular weight of 445.55 g/mol. Its IUPAC name is tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole |
| PubChem CID | 160541989 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | CC(C)(C)OC=O.O=[N+]([O-])c1ccccc1-c1csc2nc(CN3CCNCC3)cn12 |
| InChI | InChI=1S/C16H17N5O2S.C5H10O2/c22-21(23)14-4-2-1-3-13(14)15-11-24-16-18-12(10-20(15)16)9-19-7-5-17-6-8-19;1-5(2,3)7-4-6/h1-4,10-11,17H,5-9H2;4H,1-3H3 |
| InChIKey | QWXCXWRLUOCGLY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole?
The IUPAC name of tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole (CID 160541989) is tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole?
The canonical SMILES for tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole is CC(C)(C)OC=O.O=[N+]([O-])c1ccccc1-c1csc2nc(CN3CCNCC3)cn12.
What is the InChIKey of tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole?
The InChIKey is QWXCXWRLUOCGLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O2S.C5H10O2/c22-21(23)14-4-2-1-3-13(14)15-11-24-16-18-12(10-20(15)16)9-19-7-5-17-6-8-19;1-5(2,3)7-4-6/h1-4,10-11,17H,5-9H2;4H,1-3H3.
What are the key properties of tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole?
tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole has a molecular weight of 445.55 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;3-(2-nitrophenyl)-6-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 160541989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).