C10H22N2O5 — CID 160542223
2-(1-hydroxypropan-2-ylamino)acetic acid;2-(propylamino)acetic acid (PubChem CID 160542223) has the molecular formula C10H22N2O5 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-ylamino)acetic acid;2-(propylamino)acetic acid.
| Compound Name | 2-(1-hydroxypropan-2-ylamino)acetic acid;2-(propylamino)acetic acid |
|---|---|
| PubChem CID | 160542223 |
| Molecular Formula | C10H22N2O5 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-(1-hydroxypropan-2-ylamino)acetic acid;2-(propylamino)acetic acid |
| SMILES | CC(CO)NCC(=O)O.CCCNCC(=O)O |
| InChI | InChI=1S/C5H11NO3.C5H11NO2/c1-4(3-7)6-2-5(8)9;1-2-3-6-4-5(7)8/h4,6-7H,2-3H2,1H3,(H,8,9);6H,2-4H2,1H3,(H,7,8) |
| InChIKey | QWXZNPAJICZWAM-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|