C33H44ClN3O7 — CID 160542983
3-[4-chloro-3-[2-[1-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)cyclopropyl]ethyl]phenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide (PubChem CID 160542983) has the molecular formula C33H44ClN3O7 and a molecular weight of 630.18 g/mol. Its IUPAC name is 3-[4-chloro-3-[2-[1-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)cyclopropyl]ethyl]phenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide.
| Compound Name | 3-[4-chloro-3-[2-[1-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)cyclopropyl]ethyl]phenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
|---|---|
| PubChem CID | 160542983 |
| Molecular Formula | C33H44ClN3O7 |
| Molecular Weight | 630.18 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | 3-[4-chloro-3-[2-[1-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)cyclopropyl]ethyl]phenyl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
| SMILES | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)CCc1ccc(Cl)c(CCC2(C(=O)N3CCN(C4CC4)c4ccccc43)CC2)c1 |
| InChI | InChI=1S/C33H44ClN3O7/c1-35(19-27(39)30(42)31(43)28(40)20-38)29(41)11-7-21-6-10-24(34)22(18-21)12-13-33(14-15-33)32(44)37-17-16-36(23-8-9-23)25-4-2-3-5-26(25)37/h2-6,10,18,23,27-28,30-31,38-40,42-43H,7-9,11-17,19-20H2,1H3/t27-,28+,30+,31+/m0/s1 |
| InChIKey | QXAQIBPVUNEQHU-MPOKNQLQSA-N |
| XLogP | 1.90 |
| TPSA | 145.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |