C7H9N3O2Y — CID 160543253
1,4-dihydroimidazo[4,5-b]pyridine-5,7-dione;methane;yttrium (PubChem CID 160543253) has the molecular formula C7H9N3O2Y and a molecular weight of 256.07 g/mol. Its IUPAC name is 1,4-dihydroimidazo[4,5-b]pyridine-5,7-dione;methane;yttrium.
| Compound Name | 1,4-dihydroimidazo[4,5-b]pyridine-5,7-dione;methane;yttrium |
|---|---|
| PubChem CID | 160543253 |
| Molecular Formula | C7H9N3O2Y |
| Molecular Weight | 256.07 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 1,4-dihydroimidazo[4,5-b]pyridine-5,7-dione;methane;yttrium |
| SMILES | C.O=C1CC(=O)c2[nH]cnc2N1.[Y] |
| InChI | InChI=1S/C6H5N3O2.CH4.Y/c10-3-1-4(11)9-6-5(3)7-2-8-6;;/h2H,1H2,(H,7,8)(H,9,11);1H4; |
| InChIKey | QXBPNPMXWUYXCY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.07 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|