About 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane
2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane (PubChem CID 160543621) has the molecular formula C8H20NO6P
and a molecular weight of 257.22 g/mol. Its IUPAC name is 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane.
Molecular Properties
| Compound Name | 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane |
| PubChem CID | 160543621 |
| Molecular Formula | C8H20NO6P |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane |
| SMILES | C.C.CN=P(C)(OCC(=O)O)OCC(=O)O |
| InChI | InChI=1S/C6H12NO6P.2CH4/c1-7-14(2,12-3-5(8)9)13-4-6(10)11;;/h3-4H2,1-2H3,(H,8,9)(H,10,11);2*1H4 |
| InChIKey | QXCWTYGJLJOSIF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane?
The IUPAC name of 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane (CID 160543621) is 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane.
What is the SMILES notation for 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane?
The canonical SMILES for 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane is C.C.CN=P(C)(OCC(=O)O)OCC(=O)O.
What is the InChIKey of 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane?
The InChIKey is QXCWTYGJLJOSIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12NO6P.2CH4/c1-7-14(2,12-3-5(8)9)13-4-6(10)11;;/h3-4H2,1-2H3,(H,8,9)(H,10,11);2*1H4.
What are the key properties of 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane?
2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane has a molecular weight of 257.22 g/mol, XLogP of 1.75, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carboxymethoxy-methyl-methylimino-λ5-phosphanyl)oxyacetic acid;methane is sourced from PubChem (CID 160543621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).