C21H28N2O4 — CID 160543721
2-[4-(1-azatricyclo[3.3.1.13,7]decan-3-yl)-3-oxobutan-2-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 160543721) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[4-(1-azatricyclo[3.3.1.13,7]decan-3-yl)-3-oxobutan-2-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-[4-(1-azatricyclo[3.3.1.13,7]decan-3-yl)-3-oxobutan-2-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 160543721 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-[4-(1-azatricyclo[3.3.1.13,7]decan-3-yl)-3-oxobutan-2-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC(C(=O)CC12CC3CC(CN(C3)C1)C2)N1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C21H28N2O4/c1-11(23-19(25)17-15-2-3-16(27-15)18(17)20(23)26)14(24)7-21-5-12-4-13(6-21)9-22(8-12)10-21/h11-13,15-18H,2-10H2,1H3 |
| InChIKey | QXDHDIJIIDTNSB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|