About tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane
tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 160545155) has the molecular formula C21H40N4O2
and a molecular weight of 380.58 g/mol. Its IUPAC name is tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane |
| PubChem CID | 160545155 |
| Molecular Formula | C21H40N4O2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCN1C2CCC1CN(C(=O)OC(C)(C)C)C2.CCN1C2CCC1CNC2 |
| InChI | InChI=1S/C13H24N2O2.C8H16N2/c1-5-15-10-6-7-11(15)9-14(8-10)12(16)17-13(2,3)4;1-2-10-7-3-4-8(10)6-9-5-7/h10-11H,5-9H2,1-4H3;7-9H,2-6H2,1H3 |
| InChIKey | QXIBVXFYFHYHGR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane?
The IUPAC name of tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane (CID 160545155) is tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane.
What is the SMILES notation for tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane?
The canonical SMILES for tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane is CCN1C2CCC1CN(C(=O)OC(C)(C)C)C2.CCN1C2CCC1CNC2.
What is the InChIKey of tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane?
The InChIKey is QXIBVXFYFHYHGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2.C8H16N2/c1-5-15-10-6-7-11(15)9-14(8-10)12(16)17-13(2,3)4;1-2-10-7-3-4-8(10)6-9-5-7/h10-11H,5-9H2,1-4H3;7-9H,2-6H2,1H3.
What are the key properties of tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane?
tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane has a molecular weight of 380.58 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 8-ethyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate;8-ethyl-3,8-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 160545155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).