C24H34ClN3O12S5 — CID 160545284
6'-chloro-2'-(3-methoxypropyl)spiro[1,3-dioxolane-2,4'-3H-thieno[3,2-e]thiazine] 1',1'-dioxide;2'-(3-methoxypropyl)-1',1'-dioxospiro[1,3-dioxolane-2,4'-3H-thieno[3,2-e]thiazine]-6'-sulfonamide (PubChem CID 160545284) has the molecular formula C24H34ClN3O12S5 and a molecular weight of 752.33 g/mol. Its IUPAC name is 6'-chloro-2'-(3-methoxypropyl)spiro[1,3-dioxolane-2,4'-3H-thieno[3,2-e]thiazine] 1',1'-dioxide;2'-(3-methoxypropyl)-1',1'-dioxospiro[1,3-dioxolane-2,4'-3H-thieno[3,2-e]thiazine]-6'-sulfonamide.
| Compound Name | 6'-chloro-2'-(3-methoxypropyl)spiro[1,3-dioxolane-2,4'-3H-thieno[3,2-e]thiazine] 1',1'-dioxide;2'-(3-methoxypropyl)-1',1'-dioxospiro[1,3-dioxolane-2,4'-3H-thieno[3,2-e]thiazine]-6'-sulfonamide |
|---|---|
| PubChem CID | 160545284 |
| Molecular Formula | C24H34ClN3O12S5 |
| Molecular Weight | 752.33 g/mol |
| Exact Mass | 751.04 |
| IUPAC Name | 6'-chloro-2'-(3-methoxypropyl)spiro[1,3-dioxolane-2,4'-3H-thieno[3,2-e]thiazine] 1',1'-dioxide;2'-(3-methoxypropyl)-1',1'-dioxospiro[1,3-dioxolane-2,4'-3H-thieno[3,2-e]thiazine]-6'-sulfonamide |
| SMILES | COCCCN1CC2(OCCO2)c2cc(Cl)sc2S1(=O)=O.COCCCN1CC2(OCCO2)c2cc(S(N)(=O)=O)sc2S1(=O)=O |
| InChI | InChI=1S/C12H16ClNO5S2.C12H18N2O7S3/c1-17-4-2-3-14-8-12(18-5-6-19-12)9-7-10(13)20-11(9)21(14,15)16;1-19-4-2-3-14-8-12(20-5-6-21-12)9-7-10(23(13,15)16)22-11(9)24(14,17)18/h7H,2-6,8H2,1H3;7H,2-6,8H2,1H3,(H2,13,15,16) |
| InChIKey | QXIOSUHGJGEXJK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 190.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|