C13H16F3NO8 — CID 160545391
[(6R,7R)-6-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl] acetate;2,2,2-trifluoroacetic acid;hydrate (PubChem CID 160545391) has the molecular formula C13H16F3NO8 and a molecular weight of 371.26 g/mol. Its IUPAC name is [(6R,7R)-6-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl] acetate;2,2,2-trifluoroacetic acid;hydrate.
| Compound Name | [(6R,7R)-6-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl] acetate;2,2,2-trifluoroacetic acid;hydrate |
|---|---|
| PubChem CID | 160545391 |
| Molecular Formula | C13H16F3NO8 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [(6R,7R)-6-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl] acetate;2,2,2-trifluoroacetic acid;hydrate |
| SMILES | CC(=O)OC1C2O[C@@H](C3C(=O)NC(=O)C23)[C@H]1C.O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H13NO5.C2HF3O2.H2O/c1-3-7-5-6(11(15)12-10(5)14)9(17-7)8(3)16-4(2)13;3-2(4,5)1(6)7;/h3,5-9H,1-2H3,(H,12,14,15);(H,6,7);1H2/t3-,5?,6?,7-,8?,9?;;/m1../s1 |
| InChIKey | LBUACJCGHCAKRJ-QKMVSHPXSA-N |
| XLogP | -0.97 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|