About N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine
N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine (PubChem CID 160546808) has the molecular formula C13H32N4S
and a molecular weight of 276.49 g/mol. Its IUPAC name is N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine.
Molecular Properties
| Compound Name | N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine |
| PubChem CID | 160546808 |
| Molecular Formula | C13H32N4S |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine |
| SMILES | CNCCC(C)SC.CNCCCC/N=C(\C)N |
| InChI | InChI=1S/C7H17N3.C6H15NS/c1-7(8)10-6-4-3-5-9-2;1-6(8-3)4-5-7-2/h9H,3-6H2,1-2H3,(H2,8,10);6-7H,4-5H2,1-3H3 |
| InChIKey | QXNQPLWWXNIJCS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine?
The IUPAC name of N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine (CID 160546808) is N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine.
What is the SMILES notation for N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine?
The canonical SMILES for N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine is CNCCC(C)SC.CNCCCC/N=C(\C)N.
What is the InChIKey of N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine?
The InChIKey is QXNQPLWWXNIJCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3.C6H15NS/c1-7(8)10-6-4-3-5-9-2;1-6(8-3)4-5-7-2/h9H,3-6H2,1-2H3,(H2,8,10);6-7H,4-5H2,1-3H3.
What are the key properties of N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine?
N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine has a molecular weight of 276.49 g/mol, XLogP of 1.71, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(methylamino)butyl]ethanimidamide;N-methyl-3-methylsulfanylbutan-1-amine is sourced from PubChem (CID 160546808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).