C6H2Cl4F6 — CID 160547390
1,1-dichloro-3,3,3-trifluoroprop-1-ene;1,2-dichloro-3,3,3-trifluoroprop-1-ene (PubChem CID 160547390) has the molecular formula C6H2Cl4F6 and a molecular weight of 329.88 g/mol. Its IUPAC name is 1,1-dichloro-3,3,3-trifluoroprop-1-ene;1,2-dichloro-3,3,3-trifluoroprop-1-ene.
| Compound Name | 1,1-dichloro-3,3,3-trifluoroprop-1-ene;1,2-dichloro-3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 160547390 |
| Molecular Formula | C6H2Cl4F6 |
| Molecular Weight | 329.88 g/mol |
| Exact Mass | 327.88 |
| IUPAC Name | 1,1-dichloro-3,3,3-trifluoroprop-1-ene;1,2-dichloro-3,3,3-trifluoroprop-1-ene |
| SMILES | FC(F)(F)C(Cl)=CCl.FC(F)(F)C=C(Cl)Cl |
| InChI | InChI=1S/2C3HCl2F3/c4-1-2(5)3(6,7)8;4-2(5)1-3(6,7)8/h2*1H |
| InChIKey | QXPNDAGPFGGGTN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.88 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |