C28H44N4O4 — CID 160547653
(3R,5S)-2,6-dimethyl-3-propan-2-yl-2,6-diazaspiro[4.5]dec-8-ene-1,4-dione;(3S,5R)-1-methyl-3-[methyl(prop-2-enyl)amino]-5-propan-2-yl-3-prop-2-enylpyrrolidine-2,4-dione (PubChem CID 160547653) has the molecular formula C28H44N4O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is (3R,5S)-2,6-dimethyl-3-propan-2-yl-2,6-diazaspiro[4.5]dec-8-ene-1,4-dione;(3S,5R)-1-methyl-3-[methyl(prop-2-enyl)amino]-5-propan-2-yl-3-prop-2-enylpyrrolidine-2,4-dione.
| Compound Name | (3R,5S)-2,6-dimethyl-3-propan-2-yl-2,6-diazaspiro[4.5]dec-8-ene-1,4-dione;(3S,5R)-1-methyl-3-[methyl(prop-2-enyl)amino]-5-propan-2-yl-3-prop-2-enylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 160547653 |
| Molecular Formula | C28H44N4O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | (3R,5S)-2,6-dimethyl-3-propan-2-yl-2,6-diazaspiro[4.5]dec-8-ene-1,4-dione;(3S,5R)-1-methyl-3-[methyl(prop-2-enyl)amino]-5-propan-2-yl-3-prop-2-enylpyrrolidine-2,4-dione |
| SMILES | C=CCN(C)[C@@]1(CC=C)C(=O)[C@@H](C(C)C)N(C)C1=O.CC(C)[C@@H]1C(=O)[C@@]2(CC=CCN2C)C(=O)N1C |
| InChI | InChI=1S/C15H24N2O2.C13H20N2O2/c1-7-9-15(16(5)10-8-2)13(18)12(11(3)4)17(6)14(15)19;1-9(2)10-11(16)13(12(17)15(10)4)7-5-6-8-14(13)3/h7-8,11-12H,1-2,9-10H2,3-6H3;5-6,9-10H,7-8H2,1-4H3/t12-,15+;10-,13+/m11/s1 |
| InChIKey | QXQIBXOPMRYVRK-LTJRSKCKSA-N |
| XLogP | 2.17 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|