About 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid
2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid (PubChem CID 160548387) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid.
Molecular Properties
| Compound Name | 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid |
| PubChem CID | 160548387 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid |
| SMILES | CC=CCCC(C)C(=O)O.O=C1NC2C=CC1C2 |
| InChI | InChI=1S/C8H14O2.C6H7NO/c1-3-4-5-6-7(2)8(9)10;8-6-4-1-2-5(3-4)7-6/h3-4,7H,5-6H2,1-2H3,(H,9,10);1-2,4-5H,3H2,(H,7,8) |
| InChIKey | QXSRMSAZFJSRDI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid?
The IUPAC name of 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid (CID 160548387) is 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid.
What is the SMILES notation for 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid?
The canonical SMILES for 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid is CC=CCCC(C)C(=O)O.O=C1NC2C=CC1C2.
What is the InChIKey of 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid?
The InChIKey is QXSRMSAZFJSRDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C6H7NO/c1-3-4-5-6-7(2)8(9)10;8-6-4-1-2-5(3-4)7-6/h3-4,7H,5-6H2,1-2H3,(H,9,10);1-2,4-5H,3H2,(H,7,8).
What are the key properties of 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid?
2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid has a molecular weight of 251.33 g/mol, XLogP of 2.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[2.2.1]hept-5-en-3-one;2-methylhept-5-enoic acid is sourced from PubChem (CID 160548387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).