C21H27Cl2NOS — CID 160548482
(3S,4R)-3-[(3,4-dichlorophenoxy)methyl]-1-pentyl-4-thiophen-3-ylpiperidine (PubChem CID 160548482) has the molecular formula C21H27Cl2NOS and a molecular weight of 412.43 g/mol. Its IUPAC name is (3S,4R)-3-[(3,4-dichlorophenoxy)methyl]-1-pentyl-4-thiophen-3-ylpiperidine.
| Compound Name | (3S,4R)-3-[(3,4-dichlorophenoxy)methyl]-1-pentyl-4-thiophen-3-ylpiperidine |
|---|---|
| PubChem CID | 160548482 |
| Molecular Formula | C21H27Cl2NOS |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (3S,4R)-3-[(3,4-dichlorophenoxy)methyl]-1-pentyl-4-thiophen-3-ylpiperidine |
| SMILES | CCCCCN1CC[C@@H](c2ccsc2)[C@H](COc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C21H27Cl2NOS/c1-2-3-4-9-24-10-7-19(16-8-11-26-15-16)17(13-24)14-25-18-5-6-20(22)21(23)12-18/h5-6,8,11-12,15,17,19H,2-4,7,9-10,13-14H2,1H3/t17-,19-/m0/s1 |
| InChIKey | QXSZOWVMMGSXSM-HKUYNNGSSA-N |
| XLogP | 6.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|