C26H48O4 — CID 160551117
2-[(1R,3R,6S)-2,2,3,6-tetramethylcyclohexyl]-1,3-dioxolane;2-[(1R,3R,6R)-2,2,3,6-tetramethylcyclohexyl]-1,3-dioxolane (PubChem CID 160551117) has the molecular formula C26H48O4 and a molecular weight of 424.67 g/mol. Its IUPAC name is 2-[(1R,3R,6S)-2,2,3,6-tetramethylcyclohexyl]-1,3-dioxolane;2-[(1R,3R,6R)-2,2,3,6-tetramethylcyclohexyl]-1,3-dioxolane.
| Compound Name | 2-[(1R,3R,6S)-2,2,3,6-tetramethylcyclohexyl]-1,3-dioxolane;2-[(1R,3R,6R)-2,2,3,6-tetramethylcyclohexyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 160551117 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | 2-[(1R,3R,6S)-2,2,3,6-tetramethylcyclohexyl]-1,3-dioxolane;2-[(1R,3R,6R)-2,2,3,6-tetramethylcyclohexyl]-1,3-dioxolane |
| SMILES | C[C@@H]1CC[C@@H](C)C(C)(C)[C@@H]1C1OCCO1.C[C@@H]1CC[C@H](C)[C@@H](C2OCCO2)C1(C)C |
| InChI | InChI=1S/2C13H24O2/c2*1-9-5-6-10(2)13(3,4)11(9)12-14-7-8-15-12/h2*9-12H,5-8H2,1-4H3/t9-,10+,11-;9-,10-,11+/m01/s1 |
| InChIKey | QYBWBNKQZCMFRE-QHZZYHAMSA-N |
| XLogP | 6.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |