C9H28N4 — CID 160551517
N,N-dimethylethanamine;methanamine;N,N',N'-trimethylmethanediamine (PubChem CID 160551517) has the molecular formula C9H28N4 and a molecular weight of 192.35 g/mol. Its IUPAC name is N,N-dimethylethanamine;methanamine;N,N',N'-trimethylmethanediamine.
| Compound Name | N,N-dimethylethanamine;methanamine;N,N',N'-trimethylmethanediamine |
|---|---|
| PubChem CID | 160551517 |
| Molecular Formula | C9H28N4 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.23 |
| IUPAC Name | N,N-dimethylethanamine;methanamine;N,N',N'-trimethylmethanediamine |
| SMILES | CCN(C)C.CN.CNCN(C)C |
| InChI | InChI=1S/C4H12N2.C4H11N.CH5N/c1-5-4-6(2)3;1-4-5(2)3;1-2/h5H,4H2,1-3H3;4H2,1-3H3;2H2,1H3 |
| InChIKey | QYDFAXWXKFCWHF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|