About CID 160551563
CID 160551563 (PubChem CID 160551563) has the molecular formula C40H44N6O7S2
and a molecular weight of 784.96 g/mol.
Molecular Properties
| Compound Name | CID 160551563 |
| PubChem CID | 160551563 |
| Molecular Formula | C40H44N6O7S2 |
| Molecular Weight | 784.96 g/mol |
| Exact Mass | 784.27 |
| IUPAC Name | — |
| SMILES | CCNOS(=O)(=O)C1CCCC2(C1)N=c1c(=C3C(=O)C(c4ccc5cccc6c5c4NC4(CCCC(CC)C4)N6)=C3O)ccc3cccc(c13)N2.N=S(=O)=O |
| InChI | InChI=1S/C40H43N5O5S.HNO2S/c1-3-23-9-7-19-39(21-23)42-29-13-5-10-24-15-17-27(35(44-39)31(24)29)33-37(46)34(38(33)47)28-18-16-25-11-6-14-30-32(25)36(28)45-40(43-30)20-8-12-26(22-40)51(48,49)50-41-4-2;1-4(2)3/h5-6,10-11,13-18,23,26,41-44,46H,3-4,7-9,12,19-22H2,1-2H3;1H |
| InChIKey | JYLCJVYTWOWUSI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 199.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 784.96 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 160551563 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160551563?
The IUPAC name of CID 160551563 (CID 160551563) is not available.
What is the SMILES notation for CID 160551563?
The canonical SMILES for CID 160551563 is CCNOS(=O)(=O)C1CCCC2(C1)N=c1c(=C3C(=O)C(c4ccc5cccc6c5c4NC4(CCCC(CC)C4)N6)=C3O)ccc3cccc(c13)N2.N=S(=O)=O.
What is the InChIKey of CID 160551563?
The InChIKey is JYLCJVYTWOWUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H43N5O5S.HNO2S/c1-3-23-9-7-19-39(21-23)42-29-13-5-10-24-15-17-27(35(44-39)31(24)29)33-37(46)34(38(33)47)28-18-16-25-11-6-14-30-32(25)36(28)45-40(43-30)20-8-12-26(22-40)51(48,49)50-41-4-2;1-4(2)3/h5-6,10-11,13-18,23,26,41-44,46H,3-4,7-9,12,19-22H2,1-2H3;1H.
What are the key properties of CID 160551563?
CID 160551563 has a molecular weight of 784.96 g/mol, XLogP of 6.01, 6 rotatable bonds, 6 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160551563 is sourced from PubChem (CID 160551563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).