C18H24BBrN2O2 — CID 160551726
4-bromo-2-methylpyridine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 160551726) has the molecular formula C18H24BBrN2O2 and a molecular weight of 391.12 g/mol. Its IUPAC name is 4-bromo-2-methylpyridine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 4-bromo-2-methylpyridine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 160551726 |
| Molecular Formula | C18H24BBrN2O2 |
| Molecular Weight | 391.12 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-bromo-2-methylpyridine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccn1.Cc1cc(Br)ccn1 |
| InChI | InChI=1S/C12H18BNO2.C6H6BrN/c1-9-8-10(6-7-14-9)13-15-11(2,3)12(4,5)16-13;1-5-4-6(7)2-3-8-5/h6-8H,1-5H3;2-4H,1H3 |
| InChIKey | QYDXZCXCODLZFM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.12 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|