About butane-1,3-diol;bis(2-methylprop-1-ene)
butane-1,3-diol;bis(2-methylprop-1-ene) (PubChem CID 160551826) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is butane-1,3-diol;bis(2-methylprop-1-ene).
Molecular Properties
| Compound Name | butane-1,3-diol;bis(2-methylprop-1-ene) |
| PubChem CID | 160551826 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | butane-1,3-diol;bis(2-methylprop-1-ene) |
| SMILES | C=C(C)C.C=C(C)C.CC(O)CCO |
| InChI | InChI=1S/C4H10O2.2C4H8/c1-4(6)2-3-5;2*1-4(2)3/h4-6H,2-3H2,1H3;2*1H2,2-3H3 |
| InChIKey | QYEIOTXGHIBYKH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butane-1,3-diol;bis(2-methylprop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,3-diol;bis(2-methylprop-1-ene)?
The IUPAC name of butane-1,3-diol;bis(2-methylprop-1-ene) (CID 160551826) is butane-1,3-diol;bis(2-methylprop-1-ene).
What is the SMILES notation for butane-1,3-diol;bis(2-methylprop-1-ene)?
The canonical SMILES for butane-1,3-diol;bis(2-methylprop-1-ene) is C=C(C)C.C=C(C)C.CC(O)CCO.
What is the InChIKey of butane-1,3-diol;bis(2-methylprop-1-ene)?
The InChIKey is QYEIOTXGHIBYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.2C4H8/c1-4(6)2-3-5;2*1-4(2)3/h4-6H,2-3H2,1H3;2*1H2,2-3H3.
What are the key properties of butane-1,3-diol;bis(2-methylprop-1-ene)?
butane-1,3-diol;bis(2-methylprop-1-ene) has a molecular weight of 202.34 g/mol, XLogP of 2.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,3-diol;bis(2-methylprop-1-ene) is sourced from PubChem (CID 160551826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).