About (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane
(3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane (PubChem CID 160552073) has the molecular formula C9H12
and a molecular weight of 120.20 g/mol. Its IUPAC name is (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane.
Molecular Properties
| Compound Name | (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane |
| PubChem CID | 160552073 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.20 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane |
| SMILES | C=C1[C@H]2CC3CC2[C@H]1C3 |
| InChI | InChI=1S/C9H12/c1-5-7-2-6-3-8(5)9(7)4-6/h6-9H,1-4H2/t6?,7-,8+,9? |
| InChIKey | LJYHDTKLIBARGB-VGKQMMLZSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane?
The IUPAC name of (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane (CID 160552073) is (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane.
What is the SMILES notation for (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane?
The canonical SMILES for (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane is C=C1[C@H]2CC3CC2[C@H]1C3.
What is the InChIKey of (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane?
The InChIKey is LJYHDTKLIBARGB-VGKQMMLZSA-N. The full InChI is InChI=1S/C9H12/c1-5-7-2-6-3-8(5)9(7)4-6/h6-9H,1-4H2/t6?,7-,8+,9?.
What are the key properties of (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane?
(3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane has a molecular weight of 120.20 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-4-methylidenetricyclo[3.2.1.03,6]octane is sourced from PubChem (CID 160552073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).