C19H16N2O5 — CID 160554399
5-[[(3,5-dimethoxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyldiazenyl]methylidene]-2-methylidenecyclohexa-3,6-diene-1,3-dicarbaldehyde (PubChem CID 160554399) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 5-[[(3,5-dimethoxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyldiazenyl]methylidene]-2-methylidenecyclohexa-3,6-diene-1,3-dicarbaldehyde.
| Compound Name | 5-[[(3,5-dimethoxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyldiazenyl]methylidene]-2-methylidenecyclohexa-3,6-diene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 160554399 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 5-[[(3,5-dimethoxy-4-oxocyclohexa-2,5-dien-1-ylidene)methyldiazenyl]methylidene]-2-methylidenecyclohexa-3,6-diene-1,3-dicarbaldehyde |
| SMILES | C=c1c(C=O)cc(=C/N=N/C=C2C=C(OC)C(=O)C(OC)=C2)cc1C=O |
| InChI | InChI=1S/C19H16N2O5/c1-12-15(10-22)4-13(5-16(12)11-23)8-20-21-9-14-6-17(25-2)19(24)18(7-14)26-3/h4-11H,1H2,2-3H3/b21-20+ |
| InChIKey | YTYUJWSVUFNEQF-QZQOTICOSA-N |
| XLogP | 1.44 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|