About 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one
2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one (PubChem CID 160555037) has the molecular formula C11H10F3N3O2
and a molecular weight of 273.21 g/mol. Its IUPAC name is 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one |
| PubChem CID | 160555037 |
| Molecular Formula | C11H10F3N3O2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one |
| SMILES | COc1cccc(C(F)(F)F)n1.O=c1cccn[nH]1 |
| InChI | InChI=1S/C7H6F3NO.C4H4N2O/c1-12-6-4-2-3-5(11-6)7(8,9)10;7-4-2-1-3-5-6-4/h2-4H,1H3;1-3H,(H,6,7) |
| InChIKey | QYOLBHRFFDRQIX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one?
The IUPAC name of 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one (CID 160555037) is 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one.
What is the SMILES notation for 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one?
The canonical SMILES for 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one is COc1cccc(C(F)(F)F)n1.O=c1cccn[nH]1.
What is the InChIKey of 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one?
The InChIKey is QYOLBHRFFDRQIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO.C4H4N2O/c1-12-6-4-2-3-5(11-6)7(8,9)10;7-4-2-1-3-5-6-4/h2-4H,1H3;1-3H,(H,6,7).
What are the key properties of 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one?
2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one has a molecular weight of 273.21 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6-(trifluoromethyl)pyridine;1H-pyridazin-6-one is sourced from PubChem (CID 160555037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).