C10H17FN4O4P+ — CID 160555818
[(1R,2S,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium;methane (PubChem CID 160555818) has the molecular formula C10H17FN4O4P+ and a molecular weight of 307.24 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium;methane.
| Compound Name | [(1R,2S,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium;methane |
|---|---|
| PubChem CID | 160555818 |
| Molecular Formula | C10H17FN4O4P+ |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | [(1R,2S,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium;methane |
| SMILES | C.O=[P+](O)O[C@@H]1[C@@H](CO)C[C@@H](Nc2ncncn2)[C@@H]1F |
| InChI | InChI=1S/C9H12FN4O4P.CH4/c10-7-6(14-9-12-3-11-4-13-9)1-5(2-15)8(7)18-19(16)17;/h3-8,15H,1-2H2,(H-,11,12,13,14,16,17);1H4/p+1/t5-,6-,7+,8-;/m1./s1 |
| InChIKey | NYNJWMYYIGUPJP-HZIXLPQISA-O |
| XLogP | 0.67 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|