About 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum
2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum (PubChem CID 160557176) has the molecular formula C9H13NPtS
and a molecular weight of 362.36 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum.
Molecular Properties
| Compound Name | 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum |
| PubChem CID | 160557176 |
| Molecular Formula | C9H13NPtS |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum |
| SMILES | C1=C(C2=NCCS2)CCCC1.[Pt] |
| InChI | InChI=1S/C9H13NS.Pt/c1-2-4-8(5-3-1)9-10-6-7-11-9;/h4H,1-3,5-7H2; |
| InChIKey | QYVKOMXAZALGRV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum?
The IUPAC name of 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum (CID 160557176) is 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum.
What is the SMILES notation for 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum?
The canonical SMILES for 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum is C1=C(C2=NCCS2)CCCC1.[Pt].
What is the InChIKey of 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum?
The InChIKey is QYVKOMXAZALGRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS.Pt/c1-2-4-8(5-3-1)9-10-6-7-11-9;/h4H,1-3,5-7H2;.
What are the key properties of 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum?
2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum has a molecular weight of 362.36 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexen-1-yl)-4,5-dihydro-1,3-thiazole;platinum is sourced from PubChem (CID 160557176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).