C29H7F5N10O — CID 160557704
(2E)-2-[cyano(isocyano)methylidene]-5-[4-(4-isocyano-7-methyl-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile (PubChem CID 160557704) has the molecular formula C29H7F5N10O and a molecular weight of 606.43 g/mol. Its IUPAC name is (2E)-2-[cyano(isocyano)methylidene]-5-[4-(4-isocyano-7-methyl-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile.
| Compound Name | (2E)-2-[cyano(isocyano)methylidene]-5-[4-(4-isocyano-7-methyl-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 160557704 |
| Molecular Formula | C29H7F5N10O |
| Molecular Weight | 606.43 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | (2E)-2-[cyano(isocyano)methylidene]-5-[4-(4-isocyano-7-methyl-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\N=c2ccc(-c3nc(-c4nc5c([N+]#[C-])ccc(C)c5o4)nc(-c4c(F)c(F)c(F)c(F)c4F)n3)c(C#N)c2=N1 |
| InChI | InChI=1S/C29H7F5N10O/c1-10-4-6-13(37-2)23-24(10)45-29(41-23)28-43-25(42-27(44-28)16-17(30)19(32)21(34)20(33)18(16)31)11-5-7-14-22(12(11)8-35)40-26(39-14)15(9-36)38-3/h4-7H,1H3/b26-15+ |
| InChIKey | GYQRVCIUQPYWDB-CVKSISIWSA-N |
| XLogP | 5.30 |
| TPSA | 145.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|