About 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine
2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine (PubChem CID 160558326) has the molecular formula C17H20NO4S-
and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine.
Molecular Properties
| Compound Name | 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine |
| PubChem CID | 160558326 |
| Molecular Formula | C17H20NO4S- |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine |
| SMILES | CC(C)(C)N.O=C(O)c1ccc(-c2ccccc2S(=O)[O-])cc1 |
| InChI | InChI=1S/C13H10O4S.C4H11N/c14-13(15)10-7-5-9(6-8-10)11-3-1-2-4-12(11)18(16)17;1-4(2,3)5/h1-8H,(H,14,15)(H,16,17);5H2,1-3H3/p-1 |
| InChIKey | KMXVXWQZXMANGV-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine?
The IUPAC name of 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine (CID 160558326) is 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine.
What is the SMILES notation for 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine?
The canonical SMILES for 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine is CC(C)(C)N.O=C(O)c1ccc(-c2ccccc2S(=O)[O-])cc1.
What is the InChIKey of 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine?
The InChIKey is KMXVXWQZXMANGV-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H10O4S.C4H11N/c14-13(15)10-7-5-9(6-8-10)11-3-1-2-4-12(11)18(16)17;1-4(2,3)5/h1-8H,(H,14,15)(H,16,17);5H2,1-3H3/p-1.
What are the key properties of 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine?
2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine has a molecular weight of 334.42 g/mol, XLogP of 3.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-carboxyphenyl)benzenesulfinate;2-methylpropan-2-amine is sourced from PubChem (CID 160558326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).