C32H31ClF2N8O — CID 160558559
3-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-[3-(dimethylamino)azetidine-1-carboximidoyl]benzamide;methane (PubChem CID 160558559) has the molecular formula C32H31ClF2N8O and a molecular weight of 617.10 g/mol. Its IUPAC name is 3-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-[3-(dimethylamino)azetidine-1-carboximidoyl]benzamide;methane.
| Compound Name | 3-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-[3-(dimethylamino)azetidine-1-carboximidoyl]benzamide;methane |
|---|---|
| PubChem CID | 160558559 |
| Molecular Formula | C32H31ClF2N8O |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | 3-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-[3-(dimethylamino)azetidine-1-carboximidoyl]benzamide;methane |
| SMILES | C.[H]/N=C(/NC(=O)c1cccc(Nc2ncc3c(n2)-c2ccc(Cl)cc2C(c2c(F)cccc2F)=NC3)c1)N1CC(N(C)C)C1 |
| InChI | InChI=1S/C31H27ClF2N8O.CH4/c1-41(2)21-15-42(16-21)30(35)40-29(43)17-5-3-6-20(11-17)38-31-37-14-18-13-36-28(26-24(33)7-4-8-25(26)34)23-12-19(32)9-10-22(23)27(18)39-31;/h3-12,14,21H,13,15-16H2,1-2H3,(H2,35,40,43)(H,37,38,39);1H4 |
| InChIKey | QYZWOTOASLYOQB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|