About carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane
carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane (PubChem CID 160558588) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane.
Molecular Properties
| Compound Name | carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane |
| PubChem CID | 160558588 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane |
| SMILES | C.[CH3-].[H]/N=C(\C)C[NH+](C)CC=C |
| InChI | InChI=1S/C7H14N2.CH4.CH3/c1-4-5-9(3)6-7(2)8;;/h4,8H,1,5-6H2,2-3H3;1H4;1H3/q;;-1/p+1/b8-7+;; |
| InChIKey | QYZYVYBYYUDDDZ-MIIBGCIDSA-O |
| XLogP | 0.81 |
| TPSA | 28.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane?
The IUPAC name of carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane (CID 160558588) is carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane.
What is the SMILES notation for carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane?
The canonical SMILES for carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane is C.[CH3-].[H]/N=C(\C)C[NH+](C)CC=C.
What is the InChIKey of carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane?
The InChIKey is QYZYVYBYYUDDDZ-MIIBGCIDSA-O. The full InChI is InChI=1S/C7H14N2.CH4.CH3/c1-4-5-9(3)6-7(2)8;;/h4,8H,1,5-6H2,2-3H3;1H4;1H3/q;;-1/p+1/b8-7+;;.
What are the key properties of carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane?
carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane has a molecular weight of 158.29 g/mol, XLogP of 0.81, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-iminopropyl-methyl-prop-2-enylazanium;methane is sourced from PubChem (CID 160558588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).