C28H24O5S2 — CID 160559423
[(E)-2-(benzenesulfonyl)ethenyl]benzene;(2S,3S)-2-(benzenesulfonyl)-3-phenyloxirane (PubChem CID 160559423) has the molecular formula C28H24O5S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is [(E)-2-(benzenesulfonyl)ethenyl]benzene;(2S,3S)-2-(benzenesulfonyl)-3-phenyloxirane.
| Compound Name | [(E)-2-(benzenesulfonyl)ethenyl]benzene;(2S,3S)-2-(benzenesulfonyl)-3-phenyloxirane |
|---|---|
| PubChem CID | 160559423 |
| Molecular Formula | C28H24O5S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | [(E)-2-(benzenesulfonyl)ethenyl]benzene;(2S,3S)-2-(benzenesulfonyl)-3-phenyloxirane |
| SMILES | O=S(=O)(/C=C/c1ccccc1)c1ccccc1.O=S(=O)(c1ccccc1)[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H12O3S.C14H12O2S/c15-18(16,12-9-5-2-6-10-12)14-13(17-14)11-7-3-1-4-8-11;15-17(16,14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10,13-14H;1-12H/b;12-11+/t13-,14-;/m0./s1 |
| InChIKey | QZCMNOYRVYBUEM-ODBMEQQGSA-N |
| XLogP | 5.69 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|