C21H20BN3O4 — CID 160559577
2-(1-hydroxyspiro[2,1-benzoxaborole-3,1'-cyclobutane]-6-yl)-1-[1-(4-methoxyphenyl)triazol-4-yl]ethanone (PubChem CID 160559577) has the molecular formula C21H20BN3O4 and a molecular weight of 389.22 g/mol. Its IUPAC name is 2-(1-hydroxyspiro[2,1-benzoxaborole-3,1'-cyclobutane]-6-yl)-1-[1-(4-methoxyphenyl)triazol-4-yl]ethanone.
| Compound Name | 2-(1-hydroxyspiro[2,1-benzoxaborole-3,1'-cyclobutane]-6-yl)-1-[1-(4-methoxyphenyl)triazol-4-yl]ethanone |
|---|---|
| PubChem CID | 160559577 |
| Molecular Formula | C21H20BN3O4 |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-(1-hydroxyspiro[2,1-benzoxaborole-3,1'-cyclobutane]-6-yl)-1-[1-(4-methoxyphenyl)triazol-4-yl]ethanone |
| SMILES | COc1ccc(-n2cc(C(=O)Cc3ccc4c(c3)B(O)OC43CCC3)nn2)cc1 |
| InChI | InChI=1S/C21H20BN3O4/c1-28-16-6-4-15(5-7-16)25-13-19(23-24-25)20(26)12-14-3-8-17-18(11-14)22(27)29-21(17)9-2-10-21/h3-8,11,13,27H,2,9-10,12H2,1H3 |
| InChIKey | QZCXYROLEZCNSE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|