About 4,6-diphenylpyrimidine;iridium(3+)
4,6-diphenylpyrimidine;iridium(3+) (PubChem CID 160559843) has the molecular formula C16H12IrN2+3
and a molecular weight of 424.50 g/mol. Its IUPAC name is 4,6-diphenylpyrimidine;iridium(3+).
Molecular Properties
| Compound Name | 4,6-diphenylpyrimidine;iridium(3+) |
| PubChem CID | 160559843 |
| Molecular Formula | C16H12IrN2+3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4,6-diphenylpyrimidine;iridium(3+) |
| SMILES | [Ir+3].c1ccc(-c2cc(-c3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C16H12N2.Ir/c1-3-7-13(8-4-1)15-11-16(18-12-17-15)14-9-5-2-6-10-14;/h1-12H;/q;+3 |
| InChIKey | QZDUELOXUAPGCL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-diphenylpyrimidine;iridium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diphenylpyrimidine;iridium(3+)?
The IUPAC name of 4,6-diphenylpyrimidine;iridium(3+) (CID 160559843) is 4,6-diphenylpyrimidine;iridium(3+).
What is the SMILES notation for 4,6-diphenylpyrimidine;iridium(3+)?
The canonical SMILES for 4,6-diphenylpyrimidine;iridium(3+) is [Ir+3].c1ccc(-c2cc(-c3ccccc3)ncn2)cc1.
What is the InChIKey of 4,6-diphenylpyrimidine;iridium(3+)?
The InChIKey is QZDUELOXUAPGCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2.Ir/c1-3-7-13(8-4-1)15-11-16(18-12-17-15)14-9-5-2-6-10-14;/h1-12H;/q;+3.
What are the key properties of 4,6-diphenylpyrimidine;iridium(3+)?
4,6-diphenylpyrimidine;iridium(3+) has a molecular weight of 424.50 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diphenylpyrimidine;iridium(3+) is sourced from PubChem (CID 160559843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).