About N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione
N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione (PubChem CID 160559905) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione.
Molecular Properties
| Compound Name | N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione |
| PubChem CID | 160559905 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCN(C)C.CN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C13H9NO2.C5H13N/c1-14-12(15)9-6-2-4-8-5-3-7-10(11(8)9)13(14)16;1-4-5-6(2)3/h2-7H,1H3;4-5H2,1-3H3 |
| InChIKey | QZEAJTOVQNRRDG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione?
The IUPAC name of N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione (CID 160559905) is N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione.
What is the SMILES notation for N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione?
The canonical SMILES for N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione is CCCN(C)C.CN1C(=O)c2cccc3cccc(c23)C1=O.
What is the InChIKey of N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione?
The InChIKey is QZEAJTOVQNRRDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2.C5H13N/c1-14-12(15)9-6-2-4-8-5-3-7-10(11(8)9)13(14)16;1-4-5-6(2)3/h2-7H,1H3;4-5H2,1-3H3.
What are the key properties of N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione?
N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione has a molecular weight of 298.39 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpropan-1-amine;2-methylbenzo[de]isoquinoline-1,3-dione is sourced from PubChem (CID 160559905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).