About 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene
2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene (PubChem CID 160560428) has the molecular formula C19H40O2
and a molecular weight of 300.53 g/mol. Its IUPAC name is 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene.
Molecular Properties
| Compound Name | 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene |
| PubChem CID | 160560428 |
| Molecular Formula | C19H40O2 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.30 |
| IUPAC Name | 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene |
| SMILES | C=CC.CCCCCCCCC(C)(OC)C(C)(C)OCC |
| InChI | InChI=1S/C16H34O2.C3H6/c1-7-9-10-11-12-13-14-16(5,17-6)15(3,4)18-8-2;1-3-2/h7-14H2,1-6H3;3H,1H2,2H3 |
| InChIKey | QZFSRLTVBMPUMA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene?
The IUPAC name of 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene (CID 160560428) is 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene.
What is the SMILES notation for 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene?
The canonical SMILES for 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene is C=CC.CCCCCCCCC(C)(OC)C(C)(C)OCC.
What is the InChIKey of 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene?
The InChIKey is QZFSRLTVBMPUMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2.C3H6/c1-7-9-10-11-12-13-14-16(5,17-6)15(3,4)18-8-2;1-3-2/h7-14H2,1-6H3;3H,1H2,2H3.
What are the key properties of 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene?
2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene has a molecular weight of 300.53 g/mol, XLogP of 6.15, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-methoxy-2,3-dimethylundecane;prop-1-ene is sourced from PubChem (CID 160560428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).