2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid

C10H15F3N2O3 — CID 160560664

IUPAC2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.O=C1NCCC12CCCNC2
InChIInChI=1S/C8H14N2O.C2HF3O2/c11-7-8(3-5-10-7)2-1-4-9-6-8;3-2(4,5)1(6)7/h9H,1-6H2,(H,10,11);(H,6,7)
InChIKeyQZGLKXQECUQOPC-UHFFFAOYSA-N
MW268.23 g/mol
LogP0.51
Rot. Bonds

About 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid

2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid (PubChem CID 160560664) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid
PubChem CID160560664
Molecular FormulaC10H15F3N2O3
Molecular Weight268.23 g/mol
Exact Mass268.10
IUPAC Name2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.O=C1NCCC12CCCNC2
InChIInChI=1S/C8H14N2O.C2HF3O2/c11-7-8(3-5-10-7)2-1-4-9-6-8;3-2(4,5)1(6)7/h9H,1-6H2,(H,10,11);(H,6,7)
InChIKeyQZGLKXQECUQOPC-UHFFFAOYSA-N
XLogP0.51
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.23
LogP ≤ 50.51
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid?
The IUPAC name of 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid (CID 160560664) is 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid?
The canonical SMILES for 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.O=C1NCCC12CCCNC2.
What is the InChIKey of 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid?
The InChIKey is QZGLKXQECUQOPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O.C2HF3O2/c11-7-8(3-5-10-7)2-1-4-9-6-8;3-2(4,5)1(6)7/h9H,1-6H2,(H,10,11);(H,6,7).
What are the key properties of 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid?
2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid has a molecular weight of 268.23 g/mol, XLogP of 0.51, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-diazaspiro[4.5]decan-1-one;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 160560664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).