About ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide
ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide (PubChem CID 160560845) has the molecular formula C17H24O5S
and a molecular weight of 340.44 g/mol. Its IUPAC name is ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide.
Molecular Properties
| Compound Name | ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide |
| PubChem CID | 160560845 |
| Molecular Formula | C17H24O5S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide |
| SMILES | CC.CC1=C(CC(=O)C(C)C)COc2ccccc21.O=S(=O)=O |
| InChI | InChI=1S/C15H18O2.C2H6.O3S/c1-10(2)14(16)8-12-9-17-15-7-5-4-6-13(15)11(12)3;1-2;1-4(2)3/h4-7,10H,8-9H2,1-3H3;1-2H3; |
| InChIKey | QZHBPQUVIYXUIG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide?
The IUPAC name of ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide (CID 160560845) is ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide.
What is the SMILES notation for ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide?
The canonical SMILES for ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide is CC.CC1=C(CC(=O)C(C)C)COc2ccccc21.O=S(=O)=O.
What is the InChIKey of ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide?
The InChIKey is QZHBPQUVIYXUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2.C2H6.O3S/c1-10(2)14(16)8-12-9-17-15-7-5-4-6-13(15)11(12)3;1-2;1-4(2)3/h4-7,10H,8-9H2,1-3H3;1-2H3;.
What are the key properties of ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide?
ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide has a molecular weight of 340.44 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1-(4-methyl-2H-chromen-3-yl)butan-2-one;sulfur trioxide is sourced from PubChem (CID 160560845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).