C25H42Cl2MnN6O3 — CID 160561585
dichloromanganese;[(4R,9R,14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-trien-23-yl] N-(2-methoxyethyl)carbamate (PubChem CID 160561585) has the molecular formula C25H42Cl2MnN6O3 and a molecular weight of 600.49 g/mol. Its IUPAC name is dichloromanganese;[(4R,9R,14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-trien-23-yl] N-(2-methoxyethyl)carbamate.
| Compound Name | dichloromanganese;[(4R,9R,14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-trien-23-yl] N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 160561585 |
| Molecular Formula | C25H42Cl2MnN6O3 |
| Molecular Weight | 600.49 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | dichloromanganese;[(4R,9R,14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-trien-23-yl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)Oc1ccc2nc1CN[C@@H]1CCCC[C@H]1NCCN[C@@H]1CCCC[C@H]1NC2.Cl[Mn]Cl |
| InChI | InChI=1S/C25H42N6O3.2ClH.Mn/c1-33-15-14-28-25(32)34-24-11-10-18-16-29-21-8-4-2-6-19(21)26-12-13-27-20-7-3-5-9-22(20)30-17-23(24)31-18;;;/h10-11,19-22,26-27,29-30H,2-9,12-17H2,1H3,(H,28,32);2*1H;/q;;;+2/p-2/t19-,20-,21-,22-;;;/m1.../s1 |
| InChIKey | QZJPSBQOCNIMAB-JVCORYLJSA-L |
| XLogP | 3.19 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|