About tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate
tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate (PubChem CID 160563363) has the molecular formula C20H30N4O4S2
and a molecular weight of 454.62 g/mol. Its IUPAC name is tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate |
| PubChem CID | 160563363 |
| Molecular Formula | C20H30N4O4S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate |
| SMILES | Cc1cc2ncnc(SCCCCCNS(=O)(=O)NC(=O)OC(C)(C)C)c2cc1C |
| InChI | InChI=1S/C20H30N4O4S2/c1-14-11-16-17(12-15(14)2)21-13-22-18(16)29-10-8-6-7-9-23-30(26,27)24-19(25)28-20(3,4)5/h11-13,23H,6-10H2,1-5H3,(H,24,25) |
| InChIKey | QZPLEIMLJRJROD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate?
The IUPAC name of tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate (CID 160563363) is tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate.
What is the SMILES notation for tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate?
The canonical SMILES for tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate is Cc1cc2ncnc(SCCCCCNS(=O)(=O)NC(=O)OC(C)(C)C)c2cc1C.
What is the InChIKey of tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate?
The InChIKey is QZPLEIMLJRJROD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4O4S2/c1-14-11-16-17(12-15(14)2)21-13-22-18(16)29-10-8-6-7-9-23-30(26,27)24-19(25)28-20(3,4)5/h11-13,23H,6-10H2,1-5H3,(H,24,25).
What are the key properties of tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate?
tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate has a molecular weight of 454.62 g/mol, XLogP of 3.87, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-(6,7-dimethylquinazolin-4-yl)sulfanylpentylsulfamoyl]carbamate is sourced from PubChem (CID 160563363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).