C5H10N2O8S4 — CID 160564321
2λ6,4λ6,8λ6,10λ6-tetrathia-3,9-diazaspiro[5.5]undecane 2,2,4,4,8,8,10,10-octaoxide (PubChem CID 160564321) has the molecular formula C5H10N2O8S4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2λ6,4λ6,8λ6,10λ6-tetrathia-3,9-diazaspiro[5.5]undecane 2,2,4,4,8,8,10,10-octaoxide.
| Compound Name | 2λ6,4λ6,8λ6,10λ6-tetrathia-3,9-diazaspiro[5.5]undecane 2,2,4,4,8,8,10,10-octaoxide |
|---|---|
| PubChem CID | 160564321 |
| Molecular Formula | C5H10N2O8S4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | 2λ6,4λ6,8λ6,10λ6-tetrathia-3,9-diazaspiro[5.5]undecane 2,2,4,4,8,8,10,10-octaoxide |
| SMILES | O=S1(=O)CC2(CS(=O)(=O)N1)CS(=O)(=O)NS(=O)(=O)C2 |
| InChI | InChI=1S/C5H10N2O8S4/c8-16(9)1-5(2-17(10,11)6-16)3-18(12,13)7-19(14,15)4-5/h6-7H,1-4H2 |
| InChIKey | SIJRHRJCCUJFPR-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |