C15H26O12 — CID 160564439
[(3S,4S,6R)-3,4,5-trihydroxy-6-[(2R,3R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl propanoate (PubChem CID 160564439) has the molecular formula C15H26O12 and a molecular weight of 398.36 g/mol. Its IUPAC name is [(3S,4S,6R)-3,4,5-trihydroxy-6-[(2R,3R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl propanoate.
| Compound Name | [(3S,4S,6R)-3,4,5-trihydroxy-6-[(2R,3R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 160564439 |
| Molecular Formula | C15H26O12 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(3S,4S,6R)-3,4,5-trihydroxy-6-[(2R,3R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OCC1O[C@H](O[C@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H26O12/c1-2-7(17)24-4-6-9(19)11(21)13(23)15(26-6)27-14-12(22)10(20)8(18)5(3-16)25-14/h5-6,8-16,18-23H,2-4H2,1H3/t5?,6?,8-,9-,10?,11+,12-,13?,14-,15-/m1/s1 |
| InChIKey | QZSUYIQLZHOXPM-NMLZBXMRSA-N |
| XLogP | -4.44 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |