C27H48 — CID 160572216
1,3-bis(2-methylprop-1-enyl)cyclopentane;2,11-dimethyldodeca-2,10-diene (PubChem CID 160572216) has the molecular formula C27H48 and a molecular weight of 372.68 g/mol. Its IUPAC name is 1,3-bis(2-methylprop-1-enyl)cyclopentane;2,11-dimethyldodeca-2,10-diene.
| Compound Name | 1,3-bis(2-methylprop-1-enyl)cyclopentane;2,11-dimethyldodeca-2,10-diene |
|---|---|
| PubChem CID | 160572216 |
| Molecular Formula | C27H48 |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 372.38 |
| IUPAC Name | 1,3-bis(2-methylprop-1-enyl)cyclopentane;2,11-dimethyldodeca-2,10-diene |
| SMILES | CC(C)=CC1CCC(C=C(C)C)C1.CC(C)=CCCCCCCC=C(C)C |
| InChI | InChI=1S/C14H26.C13H22/c1-13(2)11-9-7-5-6-8-10-12-14(3)4;1-10(2)7-12-5-6-13(9-12)8-11(3)4/h11-12H,5-10H2,1-4H3;7-8,12-13H,5-6,9H2,1-4H3 |
| InChIKey | RARROWTWUAFLRV-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|