C34H55N3O11 — CID 160572238
tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate;bis([(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] acetate) (PubChem CID 160572238) has the molecular formula C34H55N3O11 and a molecular weight of 681.82 g/mol. Its IUPAC name is tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate;bis([(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] acetate).
| Compound Name | tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate;bis([(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] acetate) |
|---|---|
| PubChem CID | 160572238 |
| Molecular Formula | C34H55N3O11 |
| Molecular Weight | 681.82 g/mol |
| Exact Mass | 681.38 |
| IUPAC Name | tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate;bis([(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] acetate) |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](NC(=O)OC(C)(C)C)C1.CC(=O)O[C@H]1C=C[C@@H](NC(=O)OC(C)(C)C)C1.CC(C)(C)OC(=O)N[C@H]1C=C[C@@H](O)C1 |
| InChI | InChI=1S/2C12H19NO4.C10H17NO3/c2*1-8(14)16-10-6-5-9(7-10)13-11(15)17-12(2,3)4;1-10(2,3)14-9(13)11-7-4-5-8(12)6-7/h2*5-6,9-10H,7H2,1-4H3,(H,13,15);4-5,7-8,12H,6H2,1-3H3,(H,11,13)/t2*9-,10+;7-,8+/m110/s1 |
| InChIKey | RARUVWBLANSFBH-XSGPAKKLSA-N |
| XLogP | 4.74 |
| TPSA | 187.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|