About sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate
sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate (PubChem CID 160572480) has the molecular formula C10H11N4NaO4S2
and a molecular weight of 338.35 g/mol. Its IUPAC name is sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate.
Molecular Properties
| Compound Name | sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate |
| PubChem CID | 160572480 |
| Molecular Formula | C10H11N4NaO4S2 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate |
| SMILES | O=C1CCNN1.O=S(=O)([O-])c1ccc2[nH]c(=S)[nH]c2c1.[Na+] |
| InChI | InChI=1S/C7H6N2O3S2.C3H6N2O.Na/c10-14(11,12)4-1-2-5-6(3-4)9-7(13)8-5;6-3-1-2-4-5-3;/h1-3H,(H2,8,9,13)(H,10,11,12);4H,1-2H2,(H,5,6);/q;;+1/p-1 |
| InChIKey | RASODCVRKTWLQV-UHFFFAOYSA-M |
| XLogP | -2.86 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate?
The IUPAC name of sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate (CID 160572480) is sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate.
What is the SMILES notation for sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate?
The canonical SMILES for sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate is O=C1CCNN1.O=S(=O)([O-])c1ccc2[nH]c(=S)[nH]c2c1.[Na+].
What is the InChIKey of sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate?
The InChIKey is RASODCVRKTWLQV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2O3S2.C3H6N2O.Na/c10-14(11,12)4-1-2-5-6(3-4)9-7(13)8-5;6-3-1-2-4-5-3;/h1-3H,(H2,8,9,13)(H,10,11,12);4H,1-2H2,(H,5,6);/q;;+1/p-1.
What are the key properties of sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate?
sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate has a molecular weight of 338.35 g/mol, XLogP of -2.86, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;pyrazolidin-3-one;2-sulfanylidene-1,3-dihydrobenzimidazole-5-sulfonate is sourced from PubChem (CID 160572480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).