About N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine
N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine (PubChem CID 160573048) has the molecular formula C16H25NO2SSi
and a molecular weight of 323.53 g/mol. Its IUPAC name is N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine.
Molecular Properties
| Compound Name | N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine |
| PubChem CID | 160573048 |
| Molecular Formula | C16H25NO2SSi |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine |
| SMILES | CCC[SiH2]CCCN(C)c1ccc2c(c1)C(C)=CS2(=O)=O |
| InChI | InChI=1S/C16H25NO2SSi/c1-4-9-21-10-5-8-17(3)14-6-7-16-15(11-14)13(2)12-20(16,18)19/h6-7,11-12H,4-5,8-10,21H2,1-3H3 |
| InChIKey | LGCIKCFEHHPBOG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine?
The IUPAC name of N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine (CID 160573048) is N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine.
What is the SMILES notation for N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine?
The canonical SMILES for N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine is CCC[SiH2]CCCN(C)c1ccc2c(c1)C(C)=CS2(=O)=O.
What is the InChIKey of N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine?
The InChIKey is LGCIKCFEHHPBOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2SSi/c1-4-9-21-10-5-8-17(3)14-6-7-16-15(11-14)13(2)12-20(16,18)19/h6-7,11-12H,4-5,8-10,21H2,1-3H3.
What are the key properties of N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine?
N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine has a molecular weight of 323.53 g/mol, XLogP of 3.08, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-1,1-dioxo-N-(3-propylsilylpropyl)-1-benzothiophen-5-amine is sourced from PubChem (CID 160573048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).