C28H33FN2O5 — CID 160573466
6-[[4-(4-ethoxybutanoyl)-3-fluorophenyl]methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]-7,8-dimethylquinazolin-4-one (PubChem CID 160573466) has the molecular formula C28H33FN2O5 and a molecular weight of 496.58 g/mol. Its IUPAC name is 6-[[4-(4-ethoxybutanoyl)-3-fluorophenyl]methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]-7,8-dimethylquinazolin-4-one.
| Compound Name | 6-[[4-(4-ethoxybutanoyl)-3-fluorophenyl]methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]-7,8-dimethylquinazolin-4-one |
|---|---|
| PubChem CID | 160573466 |
| Molecular Formula | C28H33FN2O5 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 6-[[4-(4-ethoxybutanoyl)-3-fluorophenyl]methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]-7,8-dimethylquinazolin-4-one |
| SMILES | CCOCCCC(=O)c1ccc(Cc2cc3c(=O)n([C@H]4CCOC[C@@H]4O)cnc3c(C)c2C)cc1F |
| InChI | InChI=1S/C28H33FN2O5/c1-4-35-10-5-6-25(32)21-8-7-19(13-23(21)29)12-20-14-22-27(18(3)17(20)2)30-16-31(28(22)34)24-9-11-36-15-26(24)33/h7-8,13-14,16,24,26,33H,4-6,9-12,15H2,1-3H3/t24-,26-/m0/s1 |
| InChIKey | RAVKTAVLTFDKNG-AHWVRZQESA-N |
| XLogP | 4.06 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|