About bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane
bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane (PubChem CID 160574395) has the molecular formula C24H36O4
and a molecular weight of 388.55 g/mol. Its IUPAC name is bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane |
| PubChem CID | 160574395 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane |
| SMILES | CC1CCC(C(C)C)CC1.Cc1ccc(O)c(O)c1.Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H20.2C7H8O2/c1-8(2)10-6-4-9(3)5-7-10;2*1-5-2-3-6(8)7(9)4-5/h8-10H,4-7H2,1-3H3;2*2-4,8-9H,1H3 |
| InChIKey | RAYOHMPBPXSUCV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane?
The IUPAC name of bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane (CID 160574395) is bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane.
What is the SMILES notation for bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane?
The canonical SMILES for bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane is CC1CCC(C(C)C)CC1.Cc1ccc(O)c(O)c1.Cc1ccc(O)c(O)c1.
What is the InChIKey of bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane?
The InChIKey is RAYOHMPBPXSUCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.2C7H8O2/c1-8(2)10-6-4-9(3)5-7-10;2*1-5-2-3-6(8)7(9)4-5/h8-10H,4-7H2,1-3H3;2*2-4,8-9H,1H3.
What are the key properties of bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane?
bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane has a molecular weight of 388.55 g/mol, XLogP of 6.28, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methylbenzene-1,2-diol);1-methyl-4-propan-2-ylcyclohexane is sourced from PubChem (CID 160574395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).