C22H20F2O5S — CID 160581673
1,1-difluoro-2-spiro[3,5-dioxatricyclo[5.2.1.02,6]decane-4,9'-fluorene]-8-ylethanesulfonic acid (PubChem CID 160581673) has the molecular formula C22H20F2O5S and a molecular weight of 434.46 g/mol. Its IUPAC name is 1,1-difluoro-2-spiro[3,5-dioxatricyclo[5.2.1.02,6]decane-4,9'-fluorene]-8-ylethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-spiro[3,5-dioxatricyclo[5.2.1.02,6]decane-4,9'-fluorene]-8-ylethanesulfonic acid |
|---|---|
| PubChem CID | 160581673 |
| Molecular Formula | C22H20F2O5S |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 1,1-difluoro-2-spiro[3,5-dioxatricyclo[5.2.1.02,6]decane-4,9'-fluorene]-8-ylethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)CC1CC2CC1C1OC3(OC21)c1ccccc1-c1ccccc13 |
| InChI | InChI=1S/C22H20F2O5S/c23-21(24,30(25,26)27)11-13-9-12-10-16(13)20-19(12)28-22(29-20)17-7-3-1-5-14(17)15-6-2-4-8-18(15)22/h1-8,12-13,16,19-20H,9-11H2,(H,25,26,27) |
| InChIKey | ZPAMZLCANMOTMH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|