About N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide
N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide (PubChem CID 160581871) has the molecular formula C20H23FN2O2
and a molecular weight of 342.41 g/mol. Its IUPAC name is N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide |
| PubChem CID | 160581871 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide |
| SMILES | CCC(=O)[C@@H](NC(=O)c1cccc(-c2cccc(F)c2)n1)C(C)(C)C |
| InChI | InChI=1S/C20H23FN2O2/c1-5-17(24)18(20(2,3)4)23-19(25)16-11-7-10-15(22-16)13-8-6-9-14(21)12-13/h6-12,18H,5H2,1-4H3,(H,23,25)/t18-/m1/s1 |
| InChIKey | RBWSRBNSARLJBH-GOSISDBHSA-N |
| XLogP | 4.01 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide?
The IUPAC name of N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide (CID 160581871) is N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide.
What is the SMILES notation for N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide?
The canonical SMILES for N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide is CCC(=O)[C@@H](NC(=O)c1cccc(-c2cccc(F)c2)n1)C(C)(C)C.
What is the InChIKey of N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide?
The InChIKey is RBWSRBNSARLJBH-GOSISDBHSA-N. The full InChI is InChI=1S/C20H23FN2O2/c1-5-17(24)18(20(2,3)4)23-19(25)16-11-7-10-15(22-16)13-8-6-9-14(21)12-13/h6-12,18H,5H2,1-4H3,(H,23,25)/t18-/m1/s1.
What are the key properties of N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide?
N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide has a molecular weight of 342.41 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-2,2-dimethyl-4-oxohexan-3-yl]-6-(3-fluorophenyl)pyridine-2-carboxamide is sourced from PubChem (CID 160581871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).