About 2-nitropyridine;pyridin-2-amine
2-nitropyridine;pyridin-2-amine (PubChem CID 160583163) has the molecular formula C10H10N4O2
and a molecular weight of 218.22 g/mol. Its IUPAC name is 2-nitropyridine;pyridin-2-amine.
Molecular Properties
| Compound Name | 2-nitropyridine;pyridin-2-amine |
| PubChem CID | 160583163 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-nitropyridine;pyridin-2-amine |
| SMILES | Nc1ccccn1.O=[N+]([O-])c1ccccn1 |
| InChI | InChI=1S/C5H4N2O2.C5H6N2/c8-7(9)5-3-1-2-4-6-5;6-5-3-1-2-4-7-5/h1-4H;1-4H,(H2,6,7) |
| InChIKey | RCAWFVQBDJTMKU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitropyridine;pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitropyridine;pyridin-2-amine?
The IUPAC name of 2-nitropyridine;pyridin-2-amine (CID 160583163) is 2-nitropyridine;pyridin-2-amine.
What is the SMILES notation for 2-nitropyridine;pyridin-2-amine?
The canonical SMILES for 2-nitropyridine;pyridin-2-amine is Nc1ccccn1.O=[N+]([O-])c1ccccn1.
What is the InChIKey of 2-nitropyridine;pyridin-2-amine?
The InChIKey is RCAWFVQBDJTMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2.C5H6N2/c8-7(9)5-3-1-2-4-6-5;6-5-3-1-2-4-7-5/h1-4H;1-4H,(H2,6,7).
What are the key properties of 2-nitropyridine;pyridin-2-amine?
2-nitropyridine;pyridin-2-amine has a molecular weight of 218.22 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitropyridine;pyridin-2-amine is sourced from PubChem (CID 160583163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).