C19H20BN2O — CID 160583707
CID 160583707 (PubChem CID 160583707) has the molecular formula C19H20BN2O and a molecular weight of 303.19 g/mol.
| Compound Name | CID 160583707 |
|---|---|
| PubChem CID | 160583707 |
| Molecular Formula | C19H20BN2O |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | — |
| SMILES | C#Cc1cncc2ccc(CN3CCC(C[B]C=O)CC3)cc12 |
| InChI | InChI=1S/C19H20BN2O/c1-2-17-11-21-12-18-4-3-16(9-19(17)18)13-22-7-5-15(6-8-22)10-20-14-23/h1,3-4,9,11-12,14-15H,5-8,10,13H2 |
| InChIKey | JKSCHLRKJPCFCU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|